4-hydroxy-4-(3-methoxyphenyl)-1-methyl-3-methylidenepiperidin-2-one
Modify Date: 2025-09-27 15:38:42
4-hydroxy-4-(3-methoxyphenyl)-1-methyl-3-methylidenepiperidin-2-one structure
|
Common Name | 4-hydroxy-4-(3-methoxyphenyl)-1-methyl-3-methylidenepiperidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 61527-90-0 | Molecular Weight | 247.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hydroxy-4-(3-methoxyphenyl)-1-methyl-3-methylidenepiperidin-2-one |
|---|
| Molecular Formula | C14H17NO3 |
|---|---|
| Molecular Weight | 247.29000 |
| Exact Mass | 247.12100 |
| PSA | 49.77000 |
| LogP | 1.23900 |
| InChIKey | HDYHAGHHPIWHJA-UHFFFAOYSA-N |
| SMILES | C=C1C(=O)N(C)CCC1(O)c1cccc(OC)c1 |
|
~86%
4-hydroxy-4-(3-... CAS#:61527-90-0 |
| Literature: The United States of America as represented by the Department of Health and Human Services Patent: US4289882 A1, 1981 ; |
