2-cyclohex-3-en-1-ylethyl-dimethyl-phenylsilane
Modify Date: 2024-04-07 16:41:57
2-cyclohex-3-en-1-ylethyl-dimethyl-phenylsilane structure
|
Common Name | 2-cyclohex-3-en-1-ylethyl-dimethyl-phenylsilane | ||
|---|---|---|---|---|
| CAS Number | 61518-54-5 | Molecular Weight | 244.44700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-cyclohex-3-en-1-ylethyl-dimethyl-phenylsilane |
|---|
| Molecular Formula | C16H24Si |
|---|---|
| Molecular Weight | 244.44700 |
| Exact Mass | 244.16500 |
| LogP | 4.34840 |
| InChIKey | PCEMZMKFFDZAQZ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CCC1CC=CCC1)c1ccccc1 |
|
~%
2-cyclohex-3-en... CAS#:61518-54-5 |
| Literature: Green,M. et al. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1977 , p. 1519 - 1525 |
