N-butyl-4-chloro-2-nitroaniline structure
|
Common Name | N-butyl-4-chloro-2-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 61511-71-5 | Molecular Weight | 228.67500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-butyl-4-chloro-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13ClN2O2 |
|---|---|
| Molecular Weight | 228.67500 |
| Exact Mass | 228.06700 |
| PSA | 57.85000 |
| LogP | 4.05640 |
| InChIKey | UURLLDYIBDPBBH-UHFFFAOYSA-N |
| SMILES | CCCCNc1ccc(Cl)cc1[N+](=O)[O-] |
|
~%
N-butyl-4-chlor... CAS#:61511-71-5 |
| Literature: Feitelson et al. Journal of the Chemical Society, 1952 , p. 2389,2393 |
|
~66%
N-butyl-4-chlor... CAS#:61511-71-5 |
| Literature: Galliani, Guido; Rindone, Bruno Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 828 - 832 |
|
~%
N-butyl-4-chlor... CAS#:61511-71-5 |
| Literature: Galliani, Guido; Rindone, Bruno Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 828 - 832 |
| N-Butyl-2-nitro-4-chlor-anilin |
| N-butyl-4-chloro-2-nitro-aniline |
| Benzenamine,N-butyl-4-chloro-2-nitro |
| N-Butyl-4-chlor-2-nitro-anilin |
| N-butyl-5-chloro-2-nitroaniline |