isopropylidenediphosphonic acid structure
|
Common Name | isopropylidenediphosphonic acid | ||
|---|---|---|---|---|
| CAS Number | 6145-32-0 | Molecular Weight | 204.05500 | |
| Density | 1.752g/cm3 | Boiling Point | 503.2ºC at 760 mmHg | |
| Molecular Formula | C3H10O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.1ºC | |
| Name | 2-phosphonopropan-2-ylphosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.752g/cm3 |
|---|---|
| Boiling Point | 503.2ºC at 760 mmHg |
| Molecular Formula | C3H10O6P2 |
| Molecular Weight | 204.05500 |
| Flash Point | 258.1ºC |
| Exact Mass | 203.99500 |
| PSA | 134.68000 |
| LogP | 0.07790 |
| Index of Refraction | 1.527 |
| InChIKey | ROPQINLWRARCTM-UHFFFAOYSA-N |
| SMILES | CC(C)(P(=O)(O)O)P(=O)(O)O |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Isopropylidendiphosphorsaeure |
| propylidene-2,2-diphosphonic acid |
| propane-2,2-diphosphonic acid |
| Propan-2,2-diphosphonsaeure |
| Isopropyliden-diphosphoniumsaeure |
| Isopropylidenediphosphonic acid |