2,6-dimethyl-4-phenylpyridine-3-carboxamide
Modify Date: 2025-11-10 16:17:30
2,6-dimethyl-4-phenylpyridine-3-carboxamide structure
|
Common Name | 2,6-dimethyl-4-phenylpyridine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 61448-58-6 | Molecular Weight | 226.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-dimethyl-4-phenylpyridine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14N2O |
|---|---|
| Molecular Weight | 226.27400 |
| Exact Mass | 226.11100 |
| PSA | 56.97000 |
| LogP | 3.34850 |
| InChIKey | UGVWHBQSXCWACN-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2ccccc2)c(C(N)=O)c(C)n1 |
|
~%
2,6-dimethyl-4-... CAS#:61448-58-6 |
| Literature: Petrow Journal of the Chemical Society, 1946 , p. 200,202 |
| 2,6-Dimethyl-4-phenyl-nicotinsaeure-amid |
| 2,6-dimethyl-4-phenyl-nicotinamide |
| 2,6-Dimethyl-4-phenylpyridin-3-carboxamid |
| 2,6-dimethyl-4-phenyl-nicotinic acid amide |
| 3-Pyridinecarboxamide,2,6-dimethyl-4-phenyl |