2,6-ditert-butyl-4-(3-phenylpropyl)phenol
Modify Date: 2025-08-24 07:44:54
2,6-ditert-butyl-4-(3-phenylpropyl)phenol structure
|
Common Name | 2,6-ditert-butyl-4-(3-phenylpropyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 61424-25-7 | Molecular Weight | 324.50000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H32O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-ditert-butyl-4-(3-phenylpropyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H32O |
|---|---|
| Molecular Weight | 324.50000 |
| Exact Mass | 324.24500 |
| PSA | 20.23000 |
| LogP | 6.16250 |
| InChIKey | RGQDSJHQLPZGTJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CCCc2ccccc2)cc(C(C)(C)C)c1O |
|
~%
2,6-ditert-buty... CAS#:61424-25-7 |
| Literature: The United States of America as represented by the Secretary of Agriculture Patent: US3973040 A1, 1976 ; |
| 2,6-di-t-butyl-4-dihydrocinnamylphenol |