3,8-dimethyl-6,7-dihydro-5H-quinoline-8-carbothioamide
Modify Date: 2025-11-30 21:59:22
3,8-dimethyl-6,7-dihydro-5H-quinoline-8-carbothioamide structure
|
Common Name | 3,8-dimethyl-6,7-dihydro-5H-quinoline-8-carbothioamide | ||
|---|---|---|---|---|
| CAS Number | 61418-00-6 | Molecular Weight | 220.33400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,8-dimethyl-6,7-dihydro-5H-quinoline-8-carbothioamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16N2S |
|---|---|
| Molecular Weight | 220.33400 |
| Exact Mass | 220.10300 |
| PSA | 75.54000 |
| LogP | 2.99080 |
| InChIKey | BEAJTPYPUDZBKS-UHFFFAOYSA-N |
| SMILES | Cc1cnc2c(c1)CCCC2(C)C(N)=S |
|
~%
3,8-dimethyl-6,... CAS#:61418-00-6 |
| Literature: John Wyeth and Brother Limited Patent: US4009169 A1, 1977 ; |
|
~72%
3,8-dimethyl-6,... CAS#:61418-00-6 |
| Literature: John Wyeth and Brother Limited Patent: US4526970 A1, 1985 ; |
|
~%
3,8-dimethyl-6,... CAS#:61418-00-6 |
| Literature: Crossley, Roger; Shepherd, Robin G. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1917 - 1920 |
|
~%
3,8-dimethyl-6,... CAS#:61418-00-6 |
| Literature: Crossley, Roger; Shepherd, Robin G. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1917 - 1920 |
| 5,6,7,8-Tetrahydro-3,8-dimethylquinoline-8-thiocarboxamide |
| 3,8-Dimethyl-5,6,7,8-tetrahydroquinoline-8-thiocarboxamide |
| 8-Quinolinecarbothioamide,5,6,7,8-tetrahydro-3,8-dimethyl |
| 3,8-dimethyl-5,6,7,8-tetrahydro-quinoline-8-carbothioic acid amide |