4,4'-methylenebis[3-hydroxy-2-naphthoic] acid, compound with 10-[3-(4-hydroxypiperidin-1-yl)propyl]-10H-phenothiazine-2-carbonitrile (1:1) structure
|
Common Name | 4,4'-methylenebis[3-hydroxy-2-naphthoic] acid, compound with 10-[3-(4-hydroxypiperidin-1-yl)propyl]-10H-phenothiazine-2-carbonitrile (1:1) | ||
|---|---|---|---|---|
| CAS Number | 61389-47-7 | Molecular Weight | 753.861 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C44H39N3O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4'-Methylenebis(3-hydroxy-2-naphthoic acid)-10-[3-(4-hydroxy-1-piperidinyl)propyl]-10H-phenothiazine-2-carbonitrile (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C44H39N3O7S |
|---|---|
| Molecular Weight | 753.861 |
| Exact Mass | 753.250854 |
| InChIKey | JGTQBDIKWZNZDG-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc2c(c1)N(CCCN1CCC(O)CC1)c1ccccc1S2.O=C(O)c1cc2ccccc2c(Cc2c(O)c(C(=O)O)cc3ccccc23)c1O |
| 2-Naphthalenecarboxylic acid, 4,4'-methylenebis[3-hydroxy-, compd. with 10-[3-(4-hydroxy-1-piperidinyl)propyl]-10H-phenothiazine-2-carbonitrile (1:1) |
| 4,4'-Methylenebis(3-hydroxy-2-naphthoic acid) - 10-[3-(4-hydroxy-1-piperidinyl)propyl]-10H-phenothiazine-2-carbonitrile (1:1) |
| EINECS 262-758-0 |