4-Quinolinol,7-chloro-3-[(diethylamino)methyl]-2-methyl- structure
|
Common Name | 4-Quinolinol,7-chloro-3-[(diethylamino)methyl]-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 61342-96-9 | Molecular Weight | 278.77700 | |
| Density | 1.14g/cm3 | Boiling Point | 380.7ºC at 760 mmHg | |
| Molecular Formula | C15H19ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.1ºC | |
| Name | 7-chloro-3-(diethylaminomethyl)-2-methyl-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 380.7ºC at 760 mmHg |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.77700 |
| Flash Point | 184.1ºC |
| Exact Mass | 278.11900 |
| PSA | 36.36000 |
| LogP | 3.74400 |
| Index of Refraction | 1.551 |
| InChIKey | BCYMLTXIGVVRPV-UHFFFAOYSA-N |
| SMILES | CCN(CC)Cc1c(C)[nH]c2cc(Cl)ccc2c1=O |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-chloro-4-hydroxy-2-phenyl-quinoline-3-carboxylic acid ethyl ester |
| 7-Chlor-4-hydroxy-3-diethylaminomethylchinaldin |
| 7-Chlor-4-hydroxy-2-phenyl-chinolin-3-carbonsaeure-aethylester |
| Ethyl 7-chloro-4-hydroxy-2-phenyl-3-quinolinecarboxylate |
| 3-diethylaminomethyl-4-hydroxy-7-chloroquinaldine |
| 3-Quinolinecarboxylic acid,7-chloro-4-hydroxy-2-phenyl-,ethyl ester |