5-methyl-3-(2-nitrophenyl)-2-(2-nitrophenyl)imino-1,3-thiazolidin-4-one
Modify Date: 2025-08-25 14:57:23
5-methyl-3-(2-nitrophenyl)-2-(2-nitrophenyl)imino-1,3-thiazolidin-4-one structure
|
Common Name | 5-methyl-3-(2-nitrophenyl)-2-(2-nitrophenyl)imino-1,3-thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 61333-94-6 | Molecular Weight | 372.35500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methyl-3-(2-nitrophenyl)-2-(2-nitrophenyl)imino-1,3-thiazolidin-4-one |
|---|
| Molecular Formula | C16H12N4O5S |
|---|---|
| Molecular Weight | 372.35500 |
| Exact Mass | 372.05300 |
| PSA | 149.61000 |
| LogP | 4.77040 |
| InChIKey | QOFOGZPXHRHTOF-UHFFFAOYSA-N |
| SMILES | CC1SC(=Nc2ccccc2[N+](=O)[O-])N(c2ccccc2[N+](=O)[O-])C1=O |
|
~%
5-methyl-3-(2-n... CAS#:61333-94-6 |
| Literature: Singh Journal of the Indian Chemical Society, 1976 , vol. 53, # 6 p. 595 - 597 |
