1-[5-(furan-2-yl)-3-methylsulfanyl-1,2,4-triazol-1-yl]ethanone
Modify Date: 2025-09-18 17:43:15
![1-[5-(furan-2-yl)-3-methylsulfanyl-1,2,4-triazol-1-yl]ethanone Structure](https://image.chemsrc.com/caspic/374/61323-52-2.png)
1-[5-(furan-2-yl)-3-methylsulfanyl-1,2,4-triazol-1-yl]ethanone structure
|
Common Name | 1-[5-(furan-2-yl)-3-methylsulfanyl-1,2,4-triazol-1-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 61323-52-2 | Molecular Weight | 223.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[5-(furan-2-yl)-3-methylsulfanyl-1,2,4-triazol-1-yl]ethanone |
|---|
| Molecular Formula | C9H9N3O2S |
|---|---|
| Molecular Weight | 223.25200 |
| Exact Mass | 223.04200 |
| PSA | 86.22000 |
| LogP | 1.92010 |
| InChIKey | KVOCOMGKBCZZMU-UHFFFAOYSA-N |
| SMILES | CSc1nc(-c2ccco2)n(C(C)=O)n1 |
|
~%
1-[5-(furan-2-y... CAS#:61323-52-2 |
| Literature: Benjamin; Snyder Jr. Journal of Heterocyclic Chemistry, 1976 , vol. 13, # 5 p. 1115 - 1118 |
|
~%
1-[5-(furan-2-y... CAS#:61323-52-2 |
| Literature: Benjamin; Snyder Jr. Journal of Heterocyclic Chemistry, 1976 , vol. 13, # 5 p. 1115 - 1118 |
