(2,4-dinitrophenyl) ethyl carbonate structure
|
Common Name | (2,4-dinitrophenyl) ethyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 6132-47-4 | Molecular Weight | 256.16900 | |
| Density | 1.475g/cm3 | Boiling Point | 398.2ºC at 760 mmHg | |
| Molecular Formula | C9H8N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.2ºC | |
| Name | (2,4-dinitrophenyl) ethyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.475g/cm3 |
|---|---|
| Boiling Point | 398.2ºC at 760 mmHg |
| Molecular Formula | C9H8N2O7 |
| Molecular Weight | 256.16900 |
| Flash Point | 188.2ºC |
| Exact Mass | 256.03300 |
| PSA | 127.17000 |
| LogP | 3.08470 |
| Index of Refraction | 1.571 |
| InChIKey | UHOUQJJQUGDDMS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
(2,4-dinitrophe... CAS#:6132-47-4 |
| Literature: King; Murch Journal of the Chemical Society, 1925 , vol. 127, p. 2649 |
|
~%
(2,4-dinitrophe... CAS#:6132-47-4
Detail
|
| Literature: King; Murch Journal of the Chemical Society, 1925 , vol. 127, p. 2649 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Aethyl-(2.4-dinitro-phenyl)-carbonat |
| carbonic acid ethyl ester-(2,4-dinitro-phenyl ester) |
| 2,4-Dinitrophenyl aethyl carbonat |
| Kohlensaeure-aethylester-(2,4-dinitro-phenylester) |