1-methyl-5-(4-nitrophenyl)imidazole structure
|
Common Name | 1-methyl-5-(4-nitrophenyl)imidazole | ||
|---|---|---|---|---|
| CAS Number | 61278-68-0 | Molecular Weight | 203.19700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-5-(4-nitrophenyl)imidazole |
|---|
| Molecular Formula | C10H9N3O2 |
|---|---|
| Molecular Weight | 203.19700 |
| Exact Mass | 203.06900 |
| PSA | 63.64000 |
| LogP | 2.51850 |
| InChIKey | JRNXOIZEQNGUFD-UHFFFAOYSA-N |
| SMILES | Cn1cncc1-c1ccc([N+](=O)[O-])cc1 |
|
~75%
1-methyl-5-(4-n... CAS#:61278-68-0 |
| Literature: Baghbanzadeh, Mostafa; Pilger, Christian; Oliver Kappe Journal of Organic Chemistry, 2011 , vol. 76, # 19 p. 8138 - 8142 |
|
~%
1-methyl-5-(4-n... CAS#:61278-68-0 |
| Literature: Hazeldine; Pyman; Winchester Journal of the Chemical Society, 1924 , vol. 125, p. 1434 |