1,2,3,4,5-pentabromo-6-[2-(2,3,4,5,6-pentabromophenoxy)ethoxy]benzene
Modify Date: 2025-09-23 11:08:39
![1,2,3,4,5-pentabromo-6-[2-(2,3,4,5,6-pentabromophenoxy)ethoxy]benzene Structure](https://image.chemsrc.com/caspic/276/61262-53-1.png)
1,2,3,4,5-pentabromo-6-[2-(2,3,4,5,6-pentabromophenoxy)ethoxy]benzene structure
|
Common Name | 1,2,3,4,5-pentabromo-6-[2-(2,3,4,5,6-pentabromophenoxy)ethoxy]benzene | ||
|---|---|---|---|---|
| CAS Number | 61262-53-1 | Molecular Weight | 1005.24000 | |
| Density | 2.785g/cm3 | Boiling Point | 685.1ºC at 760 mmHg | |
| Molecular Formula | C14H6Br10O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.5ºC | |
| Name | 1,2,3,4,5-pentabromo-6-[2-(2,3,4,5,6-pentabromophenoxy)ethoxy]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.785g/cm3 |
|---|---|
| Boiling Point | 685.1ºC at 760 mmHg |
| Molecular Formula | C14H6Br10O2 |
| Molecular Weight | 1005.24000 |
| Flash Point | 291.5ºC |
| Exact Mass | 995.22000 |
| PSA | 18.46000 |
| LogP | 10.51140 |
| Index of Refraction | 1.709 |
| InChIKey | JJEPQBZQAGCZTH-UHFFFAOYSA-N |
| SMILES | Brc1c(Br)c(Br)c(OCCOc2c(Br)c(Br)c(Br)c(Br)c2Br)c(Br)c1Br |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Pyro-Chek 77B |
| HX-487 |
| decabromodiphenyl ethane |
| decabromo-1,2-diphenylethane |
| EINECS 262-680-7 |
| FireMaster 695 |