2-tert-butyl-3-(2,2-dimethylpropyl)cycloprop-2-en-1-one structure
|
Common Name | 2-tert-butyl-3-(2,2-dimethylpropyl)cycloprop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 61255-47-8 | Molecular Weight | 180.28700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-tert-butyl-3-(2,2-dimethylpropyl)cycloprop-2-en-1-one |
|---|
| Molecular Formula | C12H20O |
|---|---|
| Molecular Weight | 180.28700 |
| Exact Mass | 180.15100 |
| PSA | 17.07000 |
| LogP | 3.34800 |
| InChIKey | ROMHJWNKBITULN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Cc1c(C(C)(C)C)c1=O |
|
~%
2-tert-butyl-3-... CAS#:61255-47-8 |
| Literature: Billups,W.E.; Blakeney,A.J. Journal of the American Chemical Society, 1976 , vol. 98, # 24 p. 7817 - 7818 |