Benzenepropanoic acid, 4-amino-β-oxo-, ethyl ester structure
|
Common Name | Benzenepropanoic acid, 4-amino-β-oxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 61252-00-4 | Molecular Weight | 207.22600 | |
| Density | 1.175g/cm3 | Boiling Point | 357.7ºC at 760 mmHg | |
| Molecular Formula | C11H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.3ºC | |
| Name | ethyl 3-(4-aminophenyl)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.175g/cm3 |
|---|---|
| Boiling Point | 357.7ºC at 760 mmHg |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.22600 |
| Flash Point | 175.3ºC |
| Exact Mass | 207.09000 |
| PSA | 69.39000 |
| LogP | 1.98590 |
| Index of Refraction | 1.55 |
| InChIKey | WZNJZROGRIBUEH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1ccc(N)cc1 |
|
~76%
Benzenepropanoi... CAS#:61252-00-4 |
| Literature: Wang, Shaojie; Yan, Jufang; Wang, Xiaoyan; Yang, Zhuo; Lin, Fengwei; Zhang, Tingjian European Journal of Medicinal Chemistry, 2010 , vol. 45, # 3 p. 1250 - 1255 |
| p-Amino-benzoyl-essigsaeure-aethylester |
| <4-Amino-benzoyl>-essigsaeure-ethylester |
| ethyl 4-amino-benzoylacetate |
| 4-Amino-benzoylessigsaeure-aethylester |
| Benzenepropanoic acid, 4-amino-β-oxo-, ethyl ester |