N-[(4-fluorophenyl)methyl]benzenesulfonamide structure
|
Common Name | N-[(4-fluorophenyl)methyl]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 6125-28-6 | Molecular Weight | 265.30300 | |
| Density | 1.294g/cm3 | Boiling Point | 414.3ºC at 760 mmHg | |
| Molecular Formula | C13H12FNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.4ºC | |
| Name | N-[(4-fluorophenyl)methyl]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.294g/cm3 |
|---|---|
| Boiling Point | 414.3ºC at 760 mmHg |
| Molecular Formula | C13H12FNO2S |
| Molecular Weight | 265.30300 |
| Flash Point | 204.4ºC |
| Exact Mass | 265.05700 |
| PSA | 54.55000 |
| LogP | 3.77590 |
| Index of Refraction | 1.584 |
| InChIKey | VZFHYMWEKVIQRQ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(NCc1ccc(F)cc1)c1ccccc1 |
|
~%
N-[(4-fluorophe... CAS#:6125-28-6 |
| Literature: Hamor,G.H. Journal of Pharmaceutical Sciences, 1962 , vol. 51, p. 1109 - 1110 |
|
~%
N-[(4-fluorophe... CAS#:6125-28-6 |
| Literature: Hamor,G.H. Journal of Pharmaceutical Sciences, 1962 , vol. 51, p. 1109 - 1110 |
| 6-Sulfamoyl-2-methyl-saccharin |