3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid structure
|
Common Name | 3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 61223-34-5 | Molecular Weight | 351.97600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8Br2O4 |
|---|---|
| Molecular Weight | 351.97600 |
| Exact Mass | 349.87900 |
| PSA | 66.76000 |
| LogP | 3.02360 |
| InChIKey | ZJGHCJFPWLCJEX-UHFFFAOYSA-N |
| SMILES | COc1cc(C=CC(=O)O)c(Br)c(Br)c1O |
|
~%
3-(2,3-dibromo-... CAS#:61223-34-5 |
| Literature: Webster American Journal of Pharmacy and the Sciences Supporting Public Health (1937-1978), 1940 , vol. 112, p. 291,293, 294 |
| 5.6-Dibrom-4-hydroxy-3-methoxy-trans-zimtsaeure |
| 5.6-dibromo-4-hydroxy-3-methoxy-trans-cinnamic acid |