methyltris(phenylmethoxy)silane structure
|
Common Name | methyltris(phenylmethoxy)silane | ||
|---|---|---|---|---|
| CAS Number | 61214-13-9 | Molecular Weight | 364.51000 | |
| Density | 1.099g/cm3 | Boiling Point | 453ºC at 760 mmHg | |
| Molecular Formula | C22H24O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233ºC | |
| Name | methyl-tris(phenylmethoxy)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.099g/cm3 |
|---|---|
| Boiling Point | 453ºC at 760 mmHg |
| Molecular Formula | C22H24O3Si |
| Molecular Weight | 364.51000 |
| Flash Point | 233ºC |
| Exact Mass | 364.14900 |
| PSA | 27.69000 |
| LogP | 5.20550 |
| Index of Refraction | 1.565 |
| InChIKey | GEIHDEVWPDTQIM-UHFFFAOYSA-N |
| SMILES | C[Si](OCc1ccccc1)(OCc1ccccc1)OCc1ccccc1 |
| HS Code | 2931900090 |
|---|
|
~%
methyltris(phen... CAS#:61214-13-9 |
| Literature: Bienz, Stefan; Chapeaurouge, Alexander Helvetica Chimica Acta, 1991 , vol. 74, # 7 p. 1477 - 1488 |
|
~%
methyltris(phen... CAS#:61214-13-9 |
| Literature: Bienz, Stefan; Chapeaurouge, Alexander Helvetica Chimica Acta, 1991 , vol. 74, # 7 p. 1477 - 1488 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| einecs 262-663-4 |