3-amino-3-(4-ethoxy-naphthalen-1-yl)-propionic acid
Modify Date: 2025-11-26 18:34:33
3-amino-3-(4-ethoxy-naphthalen-1-yl)-propionic acid structure
|
Common Name | 3-amino-3-(4-ethoxy-naphthalen-1-yl)-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 612047-63-9 | Molecular Weight | 259.30000 | |
| Density | 1.22g/cm3 | Boiling Point | 461.8ºC at 760 mmHg | |
| Molecular Formula | C15H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.1ºC | |
| Name | 3-amino-3-(4-ethoxy-naphthalen-1-yl)-propionic acid |
|---|
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 461.8ºC at 760 mmHg |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30000 |
| Flash Point | 233.1ºC |
| Exact Mass | 259.12100 |
| PSA | 72.55000 |
| LogP | 3.41330 |
| Index of Refraction | 1.62 |
| InChIKey | RAUZHNFVXCYZRQ-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(N)CC(=O)O)c2ccccc12 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |