3-tert-butyl-10H-phenothiazine 5,5-dioxide
Modify Date: 2025-09-10 15:09:39
3-tert-butyl-10H-phenothiazine 5,5-dioxide structure
|
Common Name | 3-tert-butyl-10H-phenothiazine 5,5-dioxide | ||
|---|---|---|---|---|
| CAS Number | 61174-88-7 | Molecular Weight | 287.37700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-tert-butyl-10H-phenothiazine 5,5-dioxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H17NO2S |
|---|---|
| Molecular Weight | 287.37700 |
| Exact Mass | 287.09800 |
| PSA | 54.55000 |
| LogP | 5.09270 |
| InChIKey | AESDSDJQNJYHEF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc2c(c1)S(=O)(=O)c1ccccc1N2 |
|
~%
3-tert-butyl-10... CAS#:61174-88-7 |
| Literature: Cadogan,J.I.G. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1749 - 1757 |
| 3-tert-Butyl-phenothiazin-5,5-dioxid |