2-(2,6-dimethoxyphenyl)sulfonylaniline structure
|
Common Name | 2-(2,6-dimethoxyphenyl)sulfonylaniline | ||
|---|---|---|---|---|
| CAS Number | 61174-38-7 | Molecular Weight | 293.33800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,6-dimethoxyphenyl)sulfonylaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H15NO4S |
|---|---|
| Molecular Weight | 293.33800 |
| Exact Mass | 293.07200 |
| PSA | 87.00000 |
| LogP | 3.78080 |
| InChIKey | ZVEOFIFEUJLYHU-UHFFFAOYSA-N |
| SMILES | COc1cccc(OC)c1S(=O)(=O)c1ccccc1N |
|
~%
2-(2,6-dimethox... CAS#:61174-38-7 |
| Literature: Cadogan,J.I.G. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1749 - 1757 |
| 2-Aminophenyl-2,6-dimethoxyphenylsulfon |