2-[2-(trifluoromethyl)phenyl]sulfonylaniline structure
|
Common Name | 2-[2-(trifluoromethyl)phenyl]sulfonylaniline | ||
|---|---|---|---|---|
| CAS Number | 61174-34-3 | Molecular Weight | 301.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10F3NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-(trifluoromethyl)phenyl]sulfonylaniline |
|---|
| Molecular Formula | C13H10F3NO2S |
|---|---|
| Molecular Weight | 301.28400 |
| Exact Mass | 301.03800 |
| PSA | 68.54000 |
| LogP | 4.78240 |
| InChIKey | RGUFPDOQUOULLM-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1S(=O)(=O)c1ccccc1C(F)(F)F |
|
~%
2-[2-(trifluoro... CAS#:61174-34-3 |
| Literature: Cadogan,J.I.G. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1749 - 1757 |
|
~%
2-[2-(trifluoro... CAS#:61174-34-3 |
| Literature: Cadogan,J.I.G. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1749 - 1757 |