1-nitro-2-[4-(trifluoromethyl)phenyl]sulfonylbenzene structure
|
Common Name | 1-nitro-2-[4-(trifluoromethyl)phenyl]sulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 61174-23-0 | Molecular Weight | 331.26700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8F3NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-nitro-2-[4-(trifluoromethyl)phenyl]sulfonylbenzene |
|---|
| Molecular Formula | C13H8F3NO4S |
|---|---|
| Molecular Weight | 331.26700 |
| Exact Mass | 331.01300 |
| PSA | 88.34000 |
| LogP | 5.05040 |
| InChIKey | JZAFUAXENOTUMP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
|
~%
1-nitro-2-[4-(t... CAS#:61174-23-0 |
| Literature: Cadogan,J.I.G. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1749 - 1757 |