1-(3-methoxyphenyl)sulfonyl-2-nitrobenzene
Modify Date: 2024-02-04 09:30:12
1-(3-methoxyphenyl)sulfonyl-2-nitrobenzene structure
|
Common Name | 1-(3-methoxyphenyl)sulfonyl-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 61174-21-8 | Molecular Weight | 293.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3-methoxyphenyl)sulfonyl-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11NO5S |
|---|---|
| Molecular Weight | 293.29500 |
| Exact Mass | 293.03600 |
| PSA | 97.57000 |
| LogP | 4.04020 |
| InChIKey | HAJVVFCOGRXXHY-UHFFFAOYSA-N |
| SMILES | COc1cccc(S(=O)(=O)c2ccccc2[N+](=O)[O-])c1 |
|
~%
1-(3-methoxyphe... CAS#:61174-21-8 |
| Literature: Cadogan,J.I.G. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1749 - 1757 |
| 2-Nitrophenyl-3-anisylsulfon |