2,2,6,6-Tetramethyl-4-piperidinecarboxylic acid ethyl ester structure
|
Common Name | 2,2,6,6-Tetramethyl-4-piperidinecarboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 61171-34-4 | Molecular Weight | 213.31700 | |
| Density | 0.913g/cm3 | Boiling Point | 254.2ºC at 760 mmHg | |
| Molecular Formula | C12H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 107.5ºC | |
| Name | ethyl 2,2,6,6-tetramethylpiperidine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.913g/cm3 |
|---|---|
| Boiling Point | 254.2ºC at 760 mmHg |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.31700 |
| Flash Point | 107.5ºC |
| Exact Mass | 213.17300 |
| PSA | 38.33000 |
| LogP | 2.43510 |
| Index of Refraction | 1.432 |
| InChIKey | IOFIIBRTXAPWLD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC(C)(C)NC(C)(C)C1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,2,6,6-Tetramethylpiperidine-4-carboxylic acid,ethyl ester |
| 2,2,6,6-Tetramethyl-4-piperidinecarboxylic acid,ethyl ester |