dimethyl cathate structure
|
Common Name | dimethyl cathate | ||
|---|---|---|---|---|
| CAS Number | 61166-29-8 | Molecular Weight | 361.34600 | |
| Density | 1.241g/cm3 | Boiling Point | 478.5ºC at 760 mmHg | |
| Molecular Formula | C18H19NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.2ºC | |
| Name | methyl 4-[(2,6-dimethoxy-4-methoxycarbonylphenoxy)methyl]pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.241g/cm3 |
|---|---|
| Boiling Point | 478.5ºC at 760 mmHg |
| Molecular Formula | C18H19NO7 |
| Molecular Weight | 361.34600 |
| Flash Point | 243.2ºC |
| Exact Mass | 361.11600 |
| PSA | 93.18000 |
| LogP | 2.25100 |
| Index of Refraction | 1.547 |
| InChIKey | AJZQTXFCEBGQOO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c(OCc2ccncc2C(=O)OC)c(OC)c1 |
| HS Code | 2933399090 |
|---|
|
~%
dimethyl cathate CAS#:61166-29-8 |
| Literature: Stein; Nencini Farmaco, 1989 , vol. 44, # 10 p. 959 - 965 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Dimethyl cathate |
| Dimethylcathat |
| Cathic aciddimethyl ester |