1-fluoro-3-phenyl-1-(trifluoromethoxy)propan-2-one structure
|
Common Name | 1-fluoro-3-phenyl-1-(trifluoromethoxy)propan-2-one | ||
|---|---|---|---|---|
| CAS Number | 61153-50-2 | Molecular Weight | 236.16300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8F4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-fluoro-3-phenyl-1-(trifluoromethoxy)propan-2-one |
|---|
| Molecular Formula | C10H8F4O2 |
|---|---|
| Molecular Weight | 236.16300 |
| Exact Mass | 236.04600 |
| PSA | 26.30000 |
| LogP | 2.63020 |
| InChIKey | NYRHVHJWDLZHKO-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1)C(F)OC(F)(F)F |
|
~%
1-fluoro-3-phen... CAS#:61153-50-2 |
| Literature: Leroy,J.; Wakselman,C. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1978 , p. 1224 - 1227 |