diethyl 2-methyl-1,3-oxazole-4,5-dicarboxylate
Modify Date: 2025-08-25 17:49:23
diethyl 2-methyl-1,3-oxazole-4,5-dicarboxylate structure
|
Common Name | diethyl 2-methyl-1,3-oxazole-4,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 61151-88-0 | Molecular Weight | 227.21400 | |
| Density | 1.192g/cm3 | Boiling Point | 280.4ºC at 760 mmHg | |
| Molecular Formula | C10H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.4ºC | |
| Name | diethyl 2-methyl-1,3-oxazole-4,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 280.4ºC at 760 mmHg |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.21400 |
| Flash Point | 123.4ºC |
| Exact Mass | 227.07900 |
| PSA | 78.63000 |
| LogP | 1.33640 |
| Index of Refraction | 1.481 |
| InChIKey | XHUNSASFFDEEIQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1nc(C)oc1C(=O)OCC |
|
~57%
diethyl 2-meth... CAS#:61151-88-0 |
| Literature: Yokoyama; Menjo; Watanabe; Togo Synthesis, 1994 , # 12 p. 1467 - 1470 |
|
~%
diethyl 2-meth... CAS#:61151-88-0 |
| Literature: Cornforth; Cornforth Journal of the Chemical Society, 1953 , p. 93,95 |
CAS#:61151-89-1| 2-Methyl-oxazol-4,5-dicarbonsaeure-diaethylester |
| Diethyl-2-methyloxazole-4,5-dicarboxylate |
| 2-methyl-oxazole-4,5-dicarboxylic acid diethyl ester |
| diethyl 2-methyl-1,3-oxazole-4,5-dicarboxylate |