4-(3,3-dimethyl-2-phenylcyclopropen-1-yl)benzonitrile
Modify Date: 2025-09-17 18:36:27
4-(3,3-dimethyl-2-phenylcyclopropen-1-yl)benzonitrile structure
|
Common Name | 4-(3,3-dimethyl-2-phenylcyclopropen-1-yl)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 61147-74-8 | Molecular Weight | 245.31800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3,3-dimethyl-2-phenylcyclopropen-1-yl)benzonitrile |
|---|
| Molecular Formula | C18H15N |
|---|---|
| Molecular Weight | 245.31800 |
| Exact Mass | 245.12000 |
| PSA | 23.79000 |
| LogP | 4.50888 |
| InChIKey | GEOKHIKCSZEZFA-UHFFFAOYSA-N |
| SMILES | CC1(C)C(c2ccccc2)=C1c1ccc(C#N)cc1 |
|
~%
4-(3,3-dimethyl... CAS#:61147-74-8 |
| Literature: Arnold,D.R. et al. Journal of the American Chemical Society, 1976 , vol. 98, # 20 p. 6225 - 6233 |
