1-nitro-2-prop-2-enylselanylbenzene structure
|
Common Name | 1-nitro-2-prop-2-enylselanylbenzene | ||
|---|---|---|---|---|
| CAS Number | 61109-42-0 | Molecular Weight | 242.13300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9NO2Se | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-nitro-2-prop-2-enylselanylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9NO2Se |
|---|---|
| Molecular Weight | 242.13300 |
| Exact Mass | 242.98000 |
| PSA | 45.82000 |
| LogP | 2.05180 |
| InChIKey | WZVBLEUYMAJUEK-UHFFFAOYSA-N |
| SMILES | C=CC[Se]c1ccccc1[N+](=O)[O-] |
|
~67%
1-nitro-2-prop-... CAS#:61109-42-0 |
| Literature: Denmark, Scott E.; Kalyani, Dipannita; Collins, William R. Journal of the American Chemical Society, 2010 , vol. 132, # 44 p. 15752 - 15765 |
| Benzene,1-nitro-2-(2-propenylseleno) |
| allyl-2-nitrophenylselenide |