1-bis(2-chlorophenyl)phosphoryl-2-chlorobenzene structure
|
Common Name | 1-bis(2-chlorophenyl)phosphoryl-2-chlorobenzene | ||
|---|---|---|---|---|
| CAS Number | 61102-88-3 | Molecular Weight | 381.62000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H12Cl3OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-bis(2-chlorophenyl)phosphoryl-2-chlorobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H12Cl3OP |
|---|---|
| Molecular Weight | 381.62000 |
| Exact Mass | 379.96900 |
| PSA | 26.88000 |
| LogP | 5.28620 |
| InChIKey | GYRYNQDRCSYFRL-UHFFFAOYSA-N |
| SMILES | O=P(c1ccccc1Cl)(c1ccccc1Cl)c1ccccc1Cl |
|
~%
1-bis(2-chlorop... CAS#:61102-88-3 |
| Literature: Mann; Chaplin Journal of the Chemical Society, 1937 , p. 527,530 |
| tris(chlorophenyl)phosphine oxide |
| Tris-(2-chlor-phenyl)-phosphinoxid |
| tris-(2-chloro-phenyl)-phosphine oxide |
| Tri-(o-chlorphenyl)phosphinoxid |
| Phosphine oxide,tris(2-chlorophenyl) |