3-(benzenesulfinyl)-1-phenylpropan-1-one
Modify Date: 2025-08-26 00:17:51
3-(benzenesulfinyl)-1-phenylpropan-1-one structure
|
Common Name | 3-(benzenesulfinyl)-1-phenylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 61097-72-1 | Molecular Weight | 258.33500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(benzenesulfinyl)-1-phenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14O2S |
|---|---|
| Molecular Weight | 258.33500 |
| Exact Mass | 258.07100 |
| PSA | 53.35000 |
| LogP | 3.93290 |
| InChIKey | ZUXMOZPZGOIPRK-UHFFFAOYSA-N |
| SMILES | O=C(CCS(=O)c1ccccc1)c1ccccc1 |
|
~%
3-(benzenesulfi... CAS#:61097-72-1 |
| Literature: Louw,R. et al. Journal of the Chemical Society, Chemical Communications, 1976 , p. 496 - 497 |
| 1-Propanone,1-phenyl-3-(phenylsulfinyl) |