2-[2-(5-nitrofuran-2-yl)ethenyl]-4H-furo[3,2-b]indole structure
|
Common Name | 2-[2-(5-nitrofuran-2-yl)ethenyl]-4H-furo[3,2-b]indole | ||
|---|---|---|---|---|
| CAS Number | 61082-87-9 | Molecular Weight | 294.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-(5-nitrofuran-2-yl)ethenyl]-4H-furo[3,2-b]indole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H10N2O4 |
|---|---|
| Molecular Weight | 294.26200 |
| Exact Mass | 294.06400 |
| PSA | 87.89000 |
| LogP | 5.10890 |
| InChIKey | PUPQMOWDLIZKBQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C=Cc2cc3[nH]c4ccccc4c3o2)o1 |
|
~%
2-[2-(5-nitrofu... CAS#:61082-87-9 |
| Literature: Tanaka; Yakushijin; Yoshina Journal of Heterocyclic Chemistry, 1977 , vol. 14, # 6 p. 975 - 979 |
|
~%
2-[2-(5-nitrofu... CAS#:61082-87-9 |
| Literature: Tanaka; Yakushijin; Yoshina Journal of Heterocyclic Chemistry, 1977 , vol. 14, # 6 p. 975 - 979 |
| 2-[2-(5-nitro-furan-2-yl)-vinyl]-4H-furo[3,2-b]indole |
| 4H-Furo[3,2-b]indole,2-[2-(5-nitro-2-furanyl)ethenyl] |