8-benzo[1,3]dioxol-5-yl-1,9-dimethyl-3H-purine-2,6-dione structure
|
Common Name | 8-benzo[1,3]dioxol-5-yl-1,9-dimethyl-3H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 61080-31-7 | Molecular Weight | 300.26900 | |
| Density | 1.66g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H12N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-(1,3-benzodioxol-5-yl)-1,9-dimethyl-3H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66g/cm3 |
|---|---|
| Molecular Formula | C14H12N4O4 |
| Molecular Weight | 300.26900 |
| Exact Mass | 300.08600 |
| PSA | 91.14000 |
| LogP | 0.35600 |
| Index of Refraction | 1.768 |
| InChIKey | AGWXHMMNOKBBOE-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)[nH]c2c(nc(-c3ccc4c(c3)OCO4)n2C)c1=O |
|
~%
8-benzo[1,3]dio... CAS#:61080-31-7 |
| Literature: Yoneda,F.; Nagamatsu,T. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1547 - 1550 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 8-benzo[1,3]dioxol-5-yl-1,9-dimethyl-3,9-dihydro-purine-2,6-dione |