3-Amino-N-Boc-L-alanine methyl ester structure
|
Common Name | 3-Amino-N-Boc-L-alanine methyl ester | ||
|---|---|---|---|---|
| CAS Number | 61040-20-8 | Molecular Weight | 218.250 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 337.7±37.0 °C at 760 mmHg | |
| Molecular Formula | C9H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.0±26.5 °C | |
| Name | (S)-Methyl 3-amino-2-((tert-butoxycarbonyl)amino)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 337.7±37.0 °C at 760 mmHg |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.250 |
| Flash Point | 158.0±26.5 °C |
| Exact Mass | 218.126663 |
| PSA | 90.65000 |
| LogP | 1.31 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.464 |
| InChIKey | HNGRJOCEIWGCTB-LURJTMIESA-N |
| SMILES | COC(=O)C(CN)NC(=O)OC(C)(C)C |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Methyl 3-amino-N-(tert-butoxycarbonyl)-L-alaninate |
| Methyl 3-amino-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-alaninate |
| methyl (2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| L-Alanine, 3-amino-N-[(1,1-dimethylethoxy)carbonyl]-, methyl ester |