b-D-Ribofuranosylamine,N-[1,2,3]thiadiazolo[5,4-d]pyrimidin-7-yl- structure
|
Common Name | b-D-Ribofuranosylamine,N-[1,2,3]thiadiazolo[5,4-d]pyrimidin-7-yl- | ||
|---|---|---|---|---|
| CAS Number | 61038-43-5 | Molecular Weight | 285.28000 | |
| Density | 1.855g/cm3 | Boiling Point | 625.3ºC at 760 mmHg | |
| Molecular Formula | C9H11N5O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 332ºC | |
| Name | 2-(hydroxymethyl)-5-(thiadiazolo[5,4-d]pyrimidin-7-ylamino)oxolane-3,4-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.855g/cm3 |
|---|---|
| Boiling Point | 625.3ºC at 760 mmHg |
| Molecular Formula | C9H11N5O4S |
| Molecular Weight | 285.28000 |
| Flash Point | 332ºC |
| Exact Mass | 285.05300 |
| PSA | 161.75000 |
| Index of Refraction | 1.826 |
| InChIKey | UUCJATTZNJYBPE-UHFFFAOYSA-N |
| SMILES | OCC1OC(Nc2ncnc3snnc23)C(O)C1O |
|
~%
b-D-Ribofuranos... CAS#:61038-43-5 |
| Literature: Elliott; Montgomery Journal of Medicinal Chemistry, 1977 , vol. 20, # 1 p. 116 - 120 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-[1,2,3]thiadiazolo[5,4-d]pyrimidin-7-ylpentofuranosylamine |