1-(2,4-dichlorophenyl)cyclopentane-1-carboxylic acid
Modify Date: 2025-09-16 18:17:14
1-(2,4-dichlorophenyl)cyclopentane-1-carboxylic acid structure
|
Common Name | 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 61023-76-5 | Molecular Weight | 259.12800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12Cl2O2 |
|---|---|
| Molecular Weight | 259.12800 |
| Exact Mass | 258.02100 |
| PSA | 37.30000 |
| LogP | 3.88980 |
| InChIKey | CJVNUENSNUSROF-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(c2ccc(Cl)cc2Cl)CCCC1 |
|
~%
1-(2,4-dichloro... CAS#:61023-76-5 |
| Literature: Rohm and Haas Company Patent: US4105762 A1, 1978 ; Title/Abstract Full Text Show Details Rohm and Haas Company Patent: US4115578 A1, 1978 ; |
| Cyclopentanecarboxylic acid,1-(2,4-dichlorophenyl) |