1-Piperazinepropanamide,4-(3-methylphenyl)-
Modify Date: 2025-09-17 18:43:29
1-Piperazinepropanamide,4-(3-methylphenyl)- structure
|
Common Name | 1-Piperazinepropanamide,4-(3-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 61015-48-3 | Molecular Weight | 247.33600 | |
| Density | 1.104g/cm3 | Boiling Point | 476ºC at 760mmHg | |
| Molecular Formula | C14H21N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.7ºC | |
| Name | 3-[4-(3-methylphenyl)piperazin-1-yl]propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.104g/cm3 |
|---|---|
| Boiling Point | 476ºC at 760mmHg |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.33600 |
| Flash Point | 241.7ºC |
| Exact Mass | 247.16800 |
| PSA | 49.57000 |
| LogP | 1.69560 |
| Index of Refraction | 1.559 |
| InChIKey | QAJTWYJXQLKRKB-UHFFFAOYSA-N |
| SMILES | Cc1cccc(N2CCN(CCC(N)=O)CC2)c1 |
|
~%
1-Piperazinepro... CAS#:61015-48-3 |
| Literature: Pollard et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 2989 |
|
~%
1-Piperazinepro... CAS#:61015-48-3 |
| Literature: Pollard et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 2989 |
![3-[4-(3-methylphenyl)piperazin-1-yl]propanenitrile structure](https://image.chemsrc.com/caspic/075/75426-48-1.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(4-m-tolyl-piperazino)-propionic acid amide |
| 3-(4-m-Tolyl-piperazino)-propionsaeure-amid |
| 3-(4-m-tolyl-piperazin-1-yl)-propionamide |