1-(1-benzothiophen-3-yl)-3-(dimethylamino)propan-1-one structure
|
Common Name | 1-(1-benzothiophen-3-yl)-3-(dimethylamino)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 61-40-5 | Molecular Weight | 269.79000 | |
| Density | 1.158g/cm3 | Boiling Point | 368.5ºC at 760 mmHg | |
| Molecular Formula | C13H16ClNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.7ºC | |
| Name | 1-(1-benzothiophen-3-yl)-3-(dimethylamino)propan-1-one,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 368.5ºC at 760 mmHg |
| Molecular Formula | C13H16ClNOS |
| Molecular Weight | 269.79000 |
| Flash Point | 176.7ºC |
| Exact Mass | 269.06400 |
| PSA | 48.55000 |
| LogP | 3.83770 |
| Index of Refraction | 1.613 |
| InChIKey | VLWUPJUWLHHZIS-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(=O)c1csc2ccccc12.Cl |
|
~%
1-(1-benzothiop... CAS#:61-40-5 |
| Literature: Blicke; Sheets Journal of the American Chemical Society, 1949 , vol. 71, p. 2856,2858 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(1-benzothiophen-3-yl)-3-(dimethylamino)propan-1-one hydrochloride |
| 1-Benzo[b]thiophen-3-yl-3-dimethylamino-propan-1-on,Hydrochlorid |
| 1-benzo[b]thiophen-3-yl-3-dimethylamino-propan-1-one,hydrochloride |
| AQ-1989 |