5-(3-chlorophenyl)-N-prop-2-enylfuran-2-carboxamide
Modify Date: 2025-08-24 16:13:08
5-(3-chlorophenyl)-N-prop-2-enylfuran-2-carboxamide structure
|
Common Name | 5-(3-chlorophenyl)-N-prop-2-enylfuran-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 6099-29-2 | Molecular Weight | 261.70400 | |
| Density | 1.2g/cm3 | Boiling Point | 421.2ºC at 760mmHg | |
| Molecular Formula | C14H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.5ºC | |
| Name | 5-(3-chlorophenyl)-N-prop-2-enylfuran-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 421.2ºC at 760mmHg |
| Molecular Formula | C14H12ClNO2 |
| Molecular Weight | 261.70400 |
| Flash Point | 208.5ºC |
| Exact Mass | 261.05600 |
| PSA | 42.24000 |
| LogP | 3.90670 |
| Index of Refraction | 1.561 |
| InChIKey | AASZUBQRYHINBF-UHFFFAOYSA-N |
| SMILES | C=CCNC(=O)c1ccc(-c2cccc(Cl)c2)o1 |
|
~%
5-(3-chlorophen... CAS#:6099-29-2 |
| Literature: Nishio Chemical and pharmaceutical bulletin, 1967 , vol. 15, # 11 p. 1669 - 1676 |
| 2-Phenylsulfinyl-p-acetotoluidid |
| Benzolsulfinyl-essigsaeure-(4-methyl-anilid) |