4-(piperidin-4-yloxy)benzamide
Modify Date: 2025-08-26 11:53:03
4-(piperidin-4-yloxy)benzamide structure
|
Common Name | 4-(piperidin-4-yloxy)benzamide | ||
|---|---|---|---|---|
| CAS Number | 609781-30-8 | Molecular Weight | 220.26800 | |
| Density | 1.155g/cm3 | Boiling Point | 403.7ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198ºC | |
| Name | 4-(piperidin-4-yloxy)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.155g/cm3 |
|---|---|
| Boiling Point | 403.7ºC at 760 mmHg |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.26800 |
| Flash Point | 198ºC |
| Exact Mass | 220.12100 |
| PSA | 64.35000 |
| LogP | 1.94540 |
| Index of Refraction | 1.559 |
| InChIKey | CFJXVQFODGXUOM-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc(OC2CCNCC2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-piperidin-4-yloxybenzamide |