2,4,6-Pyrimidinetriamine,N4-(4-methoxyphenyl)- structure
|
Common Name | 2,4,6-Pyrimidinetriamine,N4-(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6090-49-9 | Molecular Weight | 231.25400 | |
| Density | 1.356g/cm3 | Boiling Point | 534.5ºC at 760 mmHg | |
| Molecular Formula | C11H13N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.1ºC | |
| Name | 2,4-diamino-6-p-anisidinopyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.356g/cm3 |
|---|---|
| Boiling Point | 534.5ºC at 760 mmHg |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.25400 |
| Flash Point | 277.1ºC |
| Exact Mass | 231.11200 |
| PSA | 99.08000 |
| LogP | 2.62860 |
| Index of Refraction | 1.714 |
| InChIKey | JUKHQOGWCCREDG-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2cc(N)nc(N)n2)cc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-Diamino-6-p-anisidino-pyrimidin |