(E)-3-(4-bromo-3-methylanilino)-1-(4-methylphenyl)prop-2-en-1-one
Modify Date: 2025-09-18 10:21:28
(E)-3-(4-bromo-3-methylanilino)-1-(4-methylphenyl)prop-2-en-1-one structure
|
Common Name | (E)-3-(4-bromo-3-methylanilino)-1-(4-methylphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 6085-15-0 | Molecular Weight | 330.21900 | |
| Density | 1.355g/cm3 | Boiling Point | 434.6ºC at 760mmHg | |
| Molecular Formula | C17H16BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.6ºC | |
| Name | (E)-3-(4-bromo-3-methylanilino)-1-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.355g/cm3 |
|---|---|
| Boiling Point | 434.6ºC at 760mmHg |
| Molecular Formula | C17H16BrNO |
| Molecular Weight | 330.21900 |
| Flash Point | 216.6ºC |
| Exact Mass | 329.04200 |
| PSA | 29.10000 |
| LogP | 4.94740 |
| Index of Refraction | 1.637 |
| InChIKey | WOWZLDNCAACWQC-MDZDMXLPSA-N |
| SMILES | Cc1ccc(C(=O)C=CNc2ccc(Br)c(C)c2)cc1 |
|
~%
(E)-3-(4-bromo-... CAS#:6085-15-0 |
| Literature: Schoenberg,A.; Praefcke,K. Chemische Berichte, 1966 , vol. 99, p. 196 - 204 |
|
~19%
Detail
|
| Literature: Doyle, Michael P.; Trudell, Mark L. Journal of Organic Chemistry, 1984 , vol. 49, # 7 p. 1196 - 1199 |
| ethyl 2,3,3-triethoxybutanoate |
| 2,3,3-Tri-aethoxy-buttersaeure-aethylester |