4-[(3,4-difluorophenyl)disulfanyl]-1,2-difluorobenzene
Modify Date: 2025-08-26 12:02:48
![4-[(3,4-difluorophenyl)disulfanyl]-1,2-difluorobenzene Structure](https://image.chemsrc.com/caspic/157/60811-25-8.png)
4-[(3,4-difluorophenyl)disulfanyl]-1,2-difluorobenzene structure
|
Common Name | 4-[(3,4-difluorophenyl)disulfanyl]-1,2-difluorobenzene | ||
|---|---|---|---|---|
| CAS Number | 60811-25-8 | Molecular Weight | 290.30000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H6F4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(3,4-difluorophenyl)disulfanyl]-1,2-difluorobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H6F4S2 |
|---|---|
| Molecular Weight | 290.30000 |
| Exact Mass | 289.98500 |
| PSA | 50.60000 |
| LogP | 5.04240 |
| InChIKey | KLAQFQGAEHUKGF-UHFFFAOYSA-N |
| SMILES | Fc1ccc(SSc2ccc(F)c(F)c2)cc1F |
|
~89%
4-[(3,4-difluor... CAS#:60811-25-8 |
| Literature: Dong, Wei-Li; Huang, Guang-Ying; Li, Zheng-Ming; Zhao, Wei-Guang Phosphorus, Sulfur and Silicon and the Related Elements, 2009 , vol. 184, # 8 p. 2058 - 2065 |
|
~%
4-[(3,4-difluor... CAS#:60811-25-8 |
| Literature: SPOFA, United Pharmaceutical Works Patent: US4238611 A1, 1980 ; |
| bis(3,4-difluorophenyl)disulfide |
| Disulfide,bis(3,4-difluorophenyl) |
| Bis(3,4-difluorphenyl)disulfid |