4-tert-butylphenol,formaldehyde,1,2-xylene
Modify Date: 2025-08-21 09:04:52
4-tert-butylphenol,formaldehyde,1,2-xylene structure
|
Common Name | 4-tert-butylphenol,formaldehyde,1,2-xylene | ||
|---|---|---|---|---|
| CAS Number | 60806-48-6 | Molecular Weight | 286.40900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-tert-butylphenol,formaldehyde,1,2-xylene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H26O2 |
|---|---|
| Molecular Weight | 286.40900 |
| Exact Mass | 286.19300 |
| PSA | 37.30000 |
| LogP | 5.44410 |
| InChIKey | GLFYNVUCJLGENJ-UHFFFAOYSA-N |
| SMILES | C=O.CC(C)(C)c1ccc(O)cc1.Cc1ccccc1C |
| Formaldehyde,polymer with dimethylbenzene and 4-(1,1-dimethylethyl)phenol |
| Phenol,4-(1,1-dimethylethyl)-,polymer with dimethylbenzene and formaldehyde |