1,2-bis(ethenyl)benzene,butyl prop-2-enoate,styrene structure
|
Common Name | 1,2-bis(ethenyl)benzene,butyl prop-2-enoate,styrene | ||
|---|---|---|---|---|
| CAS Number | 60806-47-5 | Molecular Weight | 362.50500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-bis(ethenyl)benzene,butyl prop-2-enoate,styrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H30O2 |
|---|---|
| Molecular Weight | 362.50500 |
| Exact Mass | 362.22500 |
| PSA | 26.30000 |
| LogP | 6.81790 |
| InChIKey | IWBUOAHJGJZERP-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCCC.C=Cc1ccccc1.C=Cc1ccccc1C=C |
| 2-Propenoic acid,butyl ester,polymer with diethenylbenzene and ethenylbenzene |