N1,N1,N4,N4-tetramethylbenzene-1,4-dicarbohydrazide
Modify Date: 2025-09-13 18:35:17
N1,N1,N4,N4-tetramethylbenzene-1,4-dicarbohydrazide structure
|
Common Name | N1,N1,N4,N4-tetramethylbenzene-1,4-dicarbohydrazide | ||
|---|---|---|---|---|
| CAS Number | 6079-87-4 | Molecular Weight | 250.29700 | |
| Density | 1.43g/cm3 | Boiling Point | 792.6ºC at 760 mmHg | |
| Molecular Formula | C12H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 433.2ºC | |
| Name | terephthalic acid bis(2,2-dimethylhydrazide) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 792.6ºC at 760 mmHg |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.29700 |
| Flash Point | 433.2ºC |
| Exact Mass | 250.14300 |
| PSA | 64.68000 |
| LogP | 0.88120 |
| Index of Refraction | 1.686 |
| InChIKey | AISRECPXJSMRCS-UHFFFAOYSA-N |
| SMILES | CN(C)NC(=O)c1ccc(C(=O)NN(C)C)cc1 |
|
~71%
N1,N1,N4,N4-tet... CAS#:6079-87-4 |
| Literature: Cates; Li; Basrur; Alkadhi Journal of Pharmaceutical Sciences, 1986 , vol. 75, # 4 p. 407 - 409 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| terbinafine |
| N-[(2E)-6,6-dimethyl-hept-2-en-4-ynyl]-N-methyl-(1-naphthylmethyl)amine hydrochloride |
| LAMISIL |
| lamosil |
| Brican |
| Terbinafine hydrochloride |
| Muzonal |
| Bricaril |
| Bricyn |
| (E)-N-(6,6-dimethyl-2-hepten-4-ynyl)-N-methyl-1-naphthalenemethanamine hydrochloride |
| Bricar |
| [(2E)-6,6-dimethylhept-2-en-4-yn-1-yl](methyl)(naphthalen-1-ylmethyl)amine hydrochloride |
| Kelger |
| Brethin |
| Terbina |