3,7-dimethylocta-2,6-dienyl 2-chloroacetate structure
|
Common Name | 3,7-dimethylocta-2,6-dienyl 2-chloroacetate | ||
|---|---|---|---|---|
| CAS Number | 60758-60-3 | Molecular Weight | 230.73100 | |
| Density | 1.01g/cm3 | Boiling Point | 311.2ºC at 760 mmHg | |
| Molecular Formula | C12H19ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.5ºC | |
| Name | 3,7-dimethylocta-2,6-dienyl 2-chloroacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 311.2ºC at 760 mmHg |
| Molecular Formula | C12H19ClO2 |
| Molecular Weight | 230.73100 |
| Flash Point | 146.5ºC |
| Exact Mass | 230.10700 |
| PSA | 26.30000 |
| LogP | 3.46110 |
| Index of Refraction | 1.473 |
| InChIKey | RDCBQKNHTPJDJX-YRNVUSSQSA-N |
| SMILES | CC(C)=CCCC(C)=CCOC(=O)CCl |
|
~91%
3,7-dimethyloct... CAS#:60758-60-3 |
| Literature: THE PROCTER and GAMBLE COMPANY Patent: EP752465 A1, 1997 ; |
|
~98%
3,7-dimethyloct... CAS#:60758-60-3 |
| Literature: Gaon, Igor; Turek, Tammy C.; Weller, Valerie A.; Edelstein, Rebecca L.; Singh, Satinder K.; Distefano, Mark D. Journal of Organic Chemistry, 1996 , vol. 61, # 22 p. 7738 - 7745 |
| 2-chloroacetyl-5,5-dimethyl-1,3-cyclohexanedione |
| chloroacetylgeraniol |
| chloroacetyldimedone |