Benzamide,N-(2,2,2-trichloro-1-phenylethyl)- structure
|
Common Name | Benzamide,N-(2,2,2-trichloro-1-phenylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 60721-37-1 | Molecular Weight | 328.62100 | |
| Density | 1.358g/cm3 | Boiling Point | 477.6ºC at 760 mmHg | |
| Molecular Formula | C15H12Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.6ºC | |
| Name | N-(2,2,2-Trichlorethyl-1-phenyl)-benzamid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.358g/cm3 |
|---|---|
| Boiling Point | 477.6ºC at 760 mmHg |
| Molecular Formula | C15H12Cl3NO |
| Molecular Weight | 328.62100 |
| Flash Point | 242.6ºC |
| Exact Mass | 326.99800 |
| PSA | 29.10000 |
| LogP | 4.91880 |
| Index of Refraction | 1.606 |
| InChIKey | HLHWLASXUWHLRM-UHFFFAOYSA-N |
| SMILES | O=C(NC(c1ccccc1)C(Cl)(Cl)Cl)c1ccccc1 |
|
~81%
Benzamide,N-(2,... CAS#:60721-37-1 |
| Literature: Bal'on, Ya. G.; Smirnov, V. A. Journal of Organic Chemistry USSR (English Translation), 1990 , vol. 26, # 11 p. 2051 - 2054 Zhurnal Organicheskoi Khimii, 1990 , vol. 26, # 11 p. 2377 - 2381 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Benzenesulfonamide,N-[(butylamino)carbonyl]-4-methoxy-3-nitro |
| N(2)-n-Butyl-N(1)-(3-nitro-4-methoxybenzenesulfonyl) Urea |